C28H27ClN4O4S — CID 58995161
N,N-dibenzyl-2-[3-(3-chloro-4-isocyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]ethanesulfonamide (PubChem CID 58995161) has the molecular formula C28H27ClN4O4S and a molecular weight of 551.07 g/mol. Its IUPAC name is N,N-dibenzyl-2-[3-(3-chloro-4-isocyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]ethanesulfonamide.
| Compound Name | N,N-dibenzyl-2-[3-(3-chloro-4-isocyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 58995161 |
| Molecular Formula | C28H27ClN4O4S |
| Molecular Weight | 551.07 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | N,N-dibenzyl-2-[3-(3-chloro-4-isocyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]ethanesulfonamide |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)N(CCS(=O)(=O)N(Cc3ccccc3)Cc3ccccc3)C(C)(C)C2=O)cc1Cl |
| InChI | InChI=1S/C28H27ClN4O4S/c1-28(2)26(34)33(23-14-15-25(30-3)24(29)18-23)27(35)32(28)16-17-38(36,37)31(19-21-10-6-4-7-11-21)20-22-12-8-5-9-13-22/h4-15,18H,16-17,19-20H2,1-2H3 |
| InChIKey | SBJOLRMKKCILST-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 82.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.07 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|