C25H31NO3 — CID 58995225
1-[4-[(2Z)-2-hydroxyimino-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]-2-methylphenyl]ethanone (PubChem CID 58995225) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is 1-[4-[(2Z)-2-hydroxyimino-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]-2-methylphenyl]ethanone.
| Compound Name | 1-[4-[(2Z)-2-hydroxyimino-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]-2-methylphenyl]ethanone |
|---|---|
| PubChem CID | 58995225 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 1-[4-[(2Z)-2-hydroxyimino-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]-2-methylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(OC/C(=N\O)c2ccc3c(c2)C(C)(C)CCC3(C)C)cc1C |
| InChI | InChI=1S/C25H31NO3/c1-16-13-19(8-9-20(16)17(2)27)29-15-23(26-28)18-7-10-21-22(14-18)25(5,6)12-11-24(21,3)4/h7-10,13-14,28H,11-12,15H2,1-6H3/b26-23+ |
| InChIKey | INYWOWXDUCMQQD-WNAAXNPUSA-N |
| XLogP | 5.80 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|