C15H23F5O3Si — CID 58995475
[1-(1,1,3,3,3-pentafluoro-2-trimethylsilyloxypropyl)cyclohexyl] prop-2-enoate (PubChem CID 58995475) has the molecular formula C15H23F5O3Si and a molecular weight of 374.42 g/mol. Its IUPAC name is [1-(1,1,3,3,3-pentafluoro-2-trimethylsilyloxypropyl)cyclohexyl] prop-2-enoate.
| Compound Name | [1-(1,1,3,3,3-pentafluoro-2-trimethylsilyloxypropyl)cyclohexyl] prop-2-enoate |
|---|---|
| PubChem CID | 58995475 |
| Molecular Formula | C15H23F5O3Si |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [1-(1,1,3,3,3-pentafluoro-2-trimethylsilyloxypropyl)cyclohexyl] prop-2-enoate |
| SMILES | C=CC(=O)OC1(C(F)(F)C(O[Si](C)(C)C)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C15H23F5O3Si/c1-5-11(21)22-13(9-7-6-8-10-13)14(16,17)12(15(18,19)20)23-24(2,3)4/h5,12H,1,6-10H2,2-4H3 |
| InChIKey | GARLXPBARDASPM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|