C19H27F5O3 — CID 58995521
[1-[1,1,3,3,3-pentafluoro-2-methyl-2-(1-methylcyclopentyl)oxypropyl]cyclohexyl] prop-2-enoate (PubChem CID 58995521) has the molecular formula C19H27F5O3 and a molecular weight of 398.41 g/mol. Its IUPAC name is [1-[1,1,3,3,3-pentafluoro-2-methyl-2-(1-methylcyclopentyl)oxypropyl]cyclohexyl] prop-2-enoate.
| Compound Name | [1-[1,1,3,3,3-pentafluoro-2-methyl-2-(1-methylcyclopentyl)oxypropyl]cyclohexyl] prop-2-enoate |
|---|---|
| PubChem CID | 58995521 |
| Molecular Formula | C19H27F5O3 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [1-[1,1,3,3,3-pentafluoro-2-methyl-2-(1-methylcyclopentyl)oxypropyl]cyclohexyl] prop-2-enoate |
| SMILES | C=CC(=O)OC1(C(F)(F)C(C)(OC2(C)CCCC2)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C19H27F5O3/c1-4-14(25)26-17(12-6-5-7-13-17)18(20,21)16(3,19(22,23)24)27-15(2)10-8-9-11-15/h4H,1,5-13H2,2-3H3 |
| InChIKey | RGADOANMRYDTCI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|