C17H21F5O3 — CID 58995539
[8-(1,1,3,3,3-pentafluoro-2-hydroxypropyl)-8-tricyclo[5.2.1.02,6]decanyl] 2-methylprop-2-enoate (PubChem CID 58995539) has the molecular formula C17H21F5O3 and a molecular weight of 368.34 g/mol. Its IUPAC name is [8-(1,1,3,3,3-pentafluoro-2-hydroxypropyl)-8-tricyclo[5.2.1.02,6]decanyl] 2-methylprop-2-enoate.
| Compound Name | [8-(1,1,3,3,3-pentafluoro-2-hydroxypropyl)-8-tricyclo[5.2.1.02,6]decanyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58995539 |
| Molecular Formula | C17H21F5O3 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [8-(1,1,3,3,3-pentafluoro-2-hydroxypropyl)-8-tricyclo[5.2.1.02,6]decanyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C(F)(F)C(O)C(F)(F)F)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C17H21F5O3/c1-8(2)13(23)25-15(16(18,19)14(24)17(20,21)22)7-9-6-12(15)11-5-3-4-10(9)11/h9-12,14,24H,1,3-7H2,2H3 |
| InChIKey | LWMIXTZVVQAXGN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|