C10H8BrF3O — CID 58995716
7-bromo-4,4,5-trifluoro-2,3-dihydro-1H-naphthalen-1-ol (PubChem CID 58995716) has the molecular formula C10H8BrF3O and a molecular weight of 281.07 g/mol. Its IUPAC name is 7-bromo-4,4,5-trifluoro-2,3-dihydro-1H-naphthalen-1-ol.
| Compound Name | 7-bromo-4,4,5-trifluoro-2,3-dihydro-1H-naphthalen-1-ol |
|---|---|
| PubChem CID | 58995716 |
| Molecular Formula | C10H8BrF3O |
| Molecular Weight | 281.07 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 7-bromo-4,4,5-trifluoro-2,3-dihydro-1H-naphthalen-1-ol |
| SMILES | OC1CCC(F)(F)c2c(F)cc(Br)cc21 |
| InChI | InChI=1S/C10H8BrF3O/c11-5-3-6-8(15)1-2-10(13,14)9(6)7(12)4-5/h3-4,8,15H,1-2H2 |
| InChIKey | MUXYBHNGLHXARF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.07 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |