About (5S)-5-methyl-1,5-dihydropyrrolizin-4-ium
(5S)-5-methyl-1,5-dihydropyrrolizin-4-ium (PubChem CID 58995829) has the molecular formula C8H10N+
and a molecular weight of 120.17 g/mol. Its IUPAC name is (5S)-5-methyl-1,5-dihydropyrrolizin-4-ium.
Molecular Properties
| Compound Name | (5S)-5-methyl-1,5-dihydropyrrolizin-4-ium |
| PubChem CID | 58995829 |
| Molecular Formula | C8H10N+ |
| Molecular Weight | 120.17 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | (5S)-5-methyl-1,5-dihydropyrrolizin-4-ium |
| SMILES | C[C@H]1C=CC2=[N+]1C=CC2 |
| InChI | InChI=1S/C8H10N/c1-7-4-5-8-3-2-6-9(7)8/h2,4-7H,3H2,1H3/q+1/t7-/m0/s1 |
| InChIKey | DWAPDJCWLARDQP-ZETCQYMHSA-N |
| XLogP | 1.32 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.17 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-methyl-1,5-dihydropyrrolizin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-methyl-1,5-dihydropyrrolizin-4-ium?
The IUPAC name of (5S)-5-methyl-1,5-dihydropyrrolizin-4-ium (CID 58995829) is (5S)-5-methyl-1,5-dihydropyrrolizin-4-ium.
What is the SMILES notation for (5S)-5-methyl-1,5-dihydropyrrolizin-4-ium?
The canonical SMILES for (5S)-5-methyl-1,5-dihydropyrrolizin-4-ium is C[C@H]1C=CC2=[N+]1C=CC2.
What is the InChIKey of (5S)-5-methyl-1,5-dihydropyrrolizin-4-ium?
The InChIKey is DWAPDJCWLARDQP-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H10N/c1-7-4-5-8-3-2-6-9(7)8/h2,4-7H,3H2,1H3/q+1/t7-/m0/s1.
What are the key properties of (5S)-5-methyl-1,5-dihydropyrrolizin-4-ium?
(5S)-5-methyl-1,5-dihydropyrrolizin-4-ium has a molecular weight of 120.17 g/mol, XLogP of 1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-methyl-1,5-dihydropyrrolizin-4-ium is sourced from PubChem (CID 58995829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).