About 2,3-dihydrofuro[2,3-d][1,3]thiazole
2,3-dihydrofuro[2,3-d][1,3]thiazole (PubChem CID 58996043) has the molecular formula C5H5NOS
and a molecular weight of 127.17 g/mol. Its IUPAC name is 2,3-dihydrofuro[2,3-d][1,3]thiazole.
Molecular Properties
| Compound Name | 2,3-dihydrofuro[2,3-d][1,3]thiazole |
| PubChem CID | 58996043 |
| Molecular Formula | C5H5NOS |
| Molecular Weight | 127.17 g/mol |
| Exact Mass | 127.01 |
| IUPAC Name | 2,3-dihydrofuro[2,3-d][1,3]thiazole |
| SMILES | c1cc2c(o1)NCS2 |
| InChI | InChI=1S/C5H5NOS/c1-2-7-5-4(1)8-3-6-5/h1-2,6H,3H2 |
| InChIKey | VEZKMYGNUJNAHL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydrofuro[2,3-d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrofuro[2,3-d][1,3]thiazole?
The IUPAC name of 2,3-dihydrofuro[2,3-d][1,3]thiazole (CID 58996043) is 2,3-dihydrofuro[2,3-d][1,3]thiazole.
What is the SMILES notation for 2,3-dihydrofuro[2,3-d][1,3]thiazole?
The canonical SMILES for 2,3-dihydrofuro[2,3-d][1,3]thiazole is c1cc2c(o1)NCS2.
What is the InChIKey of 2,3-dihydrofuro[2,3-d][1,3]thiazole?
The InChIKey is VEZKMYGNUJNAHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NOS/c1-2-7-5-4(1)8-3-6-5/h1-2,6H,3H2.
What are the key properties of 2,3-dihydrofuro[2,3-d][1,3]thiazole?
2,3-dihydrofuro[2,3-d][1,3]thiazole has a molecular weight of 127.17 g/mol, XLogP of 1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrofuro[2,3-d][1,3]thiazole is sourced from PubChem (CID 58996043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).