C24H33N5O7S4-2 — CID 58996067
3-[2-oxo-4,6-bis(sulfanylidene)-3-(3-sulfonatopropyl)-5-[2-(1,3,4-triethyl-5-methylpyrrolo[2,3-d]imidazol-2-ylidene)ethylidene]-1,3-diazinan-1-yl]propane-1-sulfonate (PubChem CID 58996067) has the molecular formula C24H33N5O7S4-2 and a molecular weight of 631.82 g/mol. Its IUPAC name is 3-[2-oxo-4,6-bis(sulfanylidene)-3-(3-sulfonatopropyl)-5-[2-(1,3,4-triethyl-5-methylpyrrolo[2,3-d]imidazol-2-ylidene)ethylidene]-1,3-diazinan-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-oxo-4,6-bis(sulfanylidene)-3-(3-sulfonatopropyl)-5-[2-(1,3,4-triethyl-5-methylpyrrolo[2,3-d]imidazol-2-ylidene)ethylidene]-1,3-diazinan-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 58996067 |
| Molecular Formula | C24H33N5O7S4-2 |
| Molecular Weight | 631.82 g/mol |
| Exact Mass | 631.13 |
| IUPAC Name | 3-[2-oxo-4,6-bis(sulfanylidene)-3-(3-sulfonatopropyl)-5-[2-(1,3,4-triethyl-5-methylpyrrolo[2,3-d]imidazol-2-ylidene)ethylidene]-1,3-diazinan-1-yl]propane-1-sulfonate |
| SMILES | CCN1C(=CC=C2C(=S)N(CCCS(=O)(=O)[O-])C(=O)N(CCCS(=O)(=O)[O-])C2=S)N(CC)c2c1cc(C)n2CC |
| InChI | InChI=1S/C24H35N5O7S4/c1-5-25-17(4)16-19-21(25)27(7-3)20(26(19)6-2)11-10-18-22(37)28(12-8-14-39(31,32)33)24(30)29(23(18)38)13-9-15-40(34,35)36/h10-11,16H,5-9,12-15H2,1-4H3,(H,31,32,33)(H,34,35,36)/p-2 |
| InChIKey | ZOSLZXBSFUXVEP-UHFFFAOYSA-L |
| XLogP | 2.51 |
| TPSA | 149.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.82 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|