About 1,2-dihydro-[1,3]oxazolo[5,4-c]pyridine
1,2-dihydro-[1,3]oxazolo[5,4-c]pyridine (PubChem CID 58996089) has the molecular formula C6H6N2O
and a molecular weight of 122.13 g/mol. Its IUPAC name is 1,2-dihydro-[1,3]oxazolo[5,4-c]pyridine.
Molecular Properties
| Compound Name | 1,2-dihydro-[1,3]oxazolo[5,4-c]pyridine |
| PubChem CID | 58996089 |
| Molecular Formula | C6H6N2O |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 1,2-dihydro-[1,3]oxazolo[5,4-c]pyridine |
| SMILES | c1cc2c(cn1)OCN2 |
| InChI | InChI=1S/C6H6N2O/c1-2-7-3-6-5(1)8-4-9-6/h1-3,8H,4H2 |
| InChIKey | BSNFXAWZSUARPE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-dihydro-[1,3]oxazolo[5,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydro-[1,3]oxazolo[5,4-c]pyridine?
The IUPAC name of 1,2-dihydro-[1,3]oxazolo[5,4-c]pyridine (CID 58996089) is 1,2-dihydro-[1,3]oxazolo[5,4-c]pyridine.
What is the SMILES notation for 1,2-dihydro-[1,3]oxazolo[5,4-c]pyridine?
The canonical SMILES for 1,2-dihydro-[1,3]oxazolo[5,4-c]pyridine is c1cc2c(cn1)OCN2.
What is the InChIKey of 1,2-dihydro-[1,3]oxazolo[5,4-c]pyridine?
The InChIKey is BSNFXAWZSUARPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O/c1-2-7-3-6-5(1)8-4-9-6/h1-3,8H,4H2.
What are the key properties of 1,2-dihydro-[1,3]oxazolo[5,4-c]pyridine?
1,2-dihydro-[1,3]oxazolo[5,4-c]pyridine has a molecular weight of 122.13 g/mol, XLogP of 0.84, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydro-[1,3]oxazolo[5,4-c]pyridine is sourced from PubChem (CID 58996089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).