C20H19ClN2O6S3 — CID 58996124
3-[2-[[3-(carboxymethyl)-5-chloro-1,3-benzothiazol-2-ylidene]methyl]-5,6-dimethylthieno[3,2-d][1,3]oxazol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 58996124) has the molecular formula C20H19ClN2O6S3 and a molecular weight of 515.03 g/mol. Its IUPAC name is 3-[2-[[3-(carboxymethyl)-5-chloro-1,3-benzothiazol-2-ylidene]methyl]-5,6-dimethylthieno[3,2-d][1,3]oxazol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[[3-(carboxymethyl)-5-chloro-1,3-benzothiazol-2-ylidene]methyl]-5,6-dimethylthieno[3,2-d][1,3]oxazol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 58996124 |
| Molecular Formula | C20H19ClN2O6S3 |
| Molecular Weight | 515.03 g/mol |
| Exact Mass | 514.01 |
| IUPAC Name | 3-[2-[[3-(carboxymethyl)-5-chloro-1,3-benzothiazol-2-ylidene]methyl]-5,6-dimethylthieno[3,2-d][1,3]oxazol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | Cc1sc2oc(C=C3Sc4ccc(Cl)cc4N3CC(=O)O)[n+](CCCS(=O)(=O)[O-])c2c1C |
| InChI | InChI=1S/C20H19ClN2O6S3/c1-11-12(2)30-20-19(11)22(6-3-7-32(26,27)28)16(29-20)9-17-23(10-18(24)25)14-8-13(21)4-5-15(14)31-17/h4-5,8-9H,3,6-7,10H2,1-2H3,(H-,24,25,26,27,28) |
| InChIKey | OZXHGRKDHYTZDB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.03 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|