About 2,3-dihydrofuro[2,3-d][1,3]oxazole
2,3-dihydrofuro[2,3-d][1,3]oxazole (PubChem CID 58996165) has the molecular formula C5H5NO2
and a molecular weight of 111.10 g/mol. Its IUPAC name is 2,3-dihydrofuro[2,3-d][1,3]oxazole.
Molecular Properties
| Compound Name | 2,3-dihydrofuro[2,3-d][1,3]oxazole |
|---|
| PubChem CID | 58996165 |
|---|
| Molecular Formula | C5H5NO2 |
|---|
| Molecular Weight | 111.10 g/mol |
|---|
| Exact Mass | 111.03 |
|---|
| IUPAC Name | 2,3-dihydrofuro[2,3-d][1,3]oxazole |
|---|
| SMILES | c1cc2c(o1)NCO2 |
|---|
| InChI | InChI=1S/C5H5NO2/c1-2-7-5-4(1)8-3-6-5/h1-2,6H,3H2 |
|---|
| InChIKey | CDIDOALTLSEMDY-UHFFFAOYSA-N |
|---|
| XLogP | 1.04 |
|---|
| TPSA | 34.40 Ų |
|---|
| H-Bond Donors | 1 |
|---|
| H-Bond Acceptors | 3 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 8 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 111.10 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydrofuro[2,3-d][1,3]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrofuro[2,3-d][1,3]oxazole?
The IUPAC name of 2,3-dihydrofuro[2,3-d][1,3]oxazole (CID 58996165) is 2,3-dihydrofuro[2,3-d][1,3]oxazole.
What is the SMILES notation for 2,3-dihydrofuro[2,3-d][1,3]oxazole?
The canonical SMILES for 2,3-dihydrofuro[2,3-d][1,3]oxazole is c1cc2c(o1)NCO2.
What is the InChIKey of 2,3-dihydrofuro[2,3-d][1,3]oxazole?
The InChIKey is CDIDOALTLSEMDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2/c1-2-7-5-4(1)8-3-6-5/h1-2,6H,3H2.
What are the key properties of 2,3-dihydrofuro[2,3-d][1,3]oxazole?
2,3-dihydrofuro[2,3-d][1,3]oxazole has a molecular weight of 111.10 g/mol, XLogP of 1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrofuro[2,3-d][1,3]oxazole is sourced from PubChem (CID 58996165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).