C14H23NO7 — CID 58996824
2-[(4-methoxy-4-oxobutanoyl)amino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (PubChem CID 58996824) has the molecular formula C14H23NO7 and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-[(4-methoxy-4-oxobutanoyl)amino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid.
| Compound Name | 2-[(4-methoxy-4-oxobutanoyl)amino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 58996824 |
| Molecular Formula | C14H23NO7 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2-[(4-methoxy-4-oxobutanoyl)amino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| SMILES | COC(=O)CCC(=O)NC(CCC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H23NO7/c1-14(2,3)22-12(18)7-5-9(13(19)20)15-10(16)6-8-11(17)21-4/h9H,5-8H2,1-4H3,(H,15,16)(H,19,20) |
| InChIKey | WUQLXOHOSYQXHD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |