C18H26N4 — CID 58997062
N',N'-bis(1-pyridin-2-ylethyl)butane-1,4-diamine (PubChem CID 58997062) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is N',N'-bis(1-pyridin-2-ylethyl)butane-1,4-diamine.
| Compound Name | N',N'-bis(1-pyridin-2-ylethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 58997062 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | N',N'-bis(1-pyridin-2-ylethyl)butane-1,4-diamine |
| SMILES | CC(c1ccccn1)N(CCCCN)C(C)c1ccccn1 |
| InChI | InChI=1S/C18H26N4/c1-15(17-9-3-6-12-20-17)22(14-8-5-11-19)16(2)18-10-4-7-13-21-18/h3-4,6-7,9-10,12-13,15-16H,5,8,11,14,19H2,1-2H3 |
| InChIKey | ZTGCKWKPBVUNIW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|