C16H18F3N3O2 — CID 58997424
(2R,6R)-4-[4-amino-3-(trifluoromethyl)phenyl]-6-hydroxy-3,4-diazatricyclo[5.2.2.02,6]undecan-5-one (PubChem CID 58997424) has the molecular formula C16H18F3N3O2 and a molecular weight of 341.33 g/mol. Its IUPAC name is (2R,6R)-4-[4-amino-3-(trifluoromethyl)phenyl]-6-hydroxy-3,4-diazatricyclo[5.2.2.02,6]undecan-5-one.
| Compound Name | (2R,6R)-4-[4-amino-3-(trifluoromethyl)phenyl]-6-hydroxy-3,4-diazatricyclo[5.2.2.02,6]undecan-5-one |
|---|---|
| PubChem CID | 58997424 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2R,6R)-4-[4-amino-3-(trifluoromethyl)phenyl]-6-hydroxy-3,4-diazatricyclo[5.2.2.02,6]undecan-5-one |
| SMILES | Nc1ccc(N2N[C@@H]3C4CCC(CC4)[C@]3(O)C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C16H18F3N3O2/c17-16(18,19)11-7-10(5-6-12(11)20)22-14(23)15(24)9-3-1-8(2-4-9)13(15)21-22/h5-9,13,21,24H,1-4,20H2/t8?,9?,13-,15-/m1/s1 |
| InChIKey | MNBWADUWIYIWSZ-SPMUZYDJSA-N |
| XLogP | 2.06 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|