C11H14FNO — CID 58997658
N-[3-(4-fluorophenyl)propyl]acetamide (PubChem CID 58997658) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)propyl]acetamide.
| Compound Name | N-[3-(4-fluorophenyl)propyl]acetamide |
|---|---|
| PubChem CID | 58997658 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | N-[3-(4-fluorophenyl)propyl]acetamide |
| SMILES | CC(=O)NCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FNO/c1-9(14)13-8-2-3-10-4-6-11(12)7-5-10/h4-7H,2-3,8H2,1H3,(H,13,14) |
| InChIKey | VIPHDKAJRACYMV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|