C27H40FN5O2S — CID 58997693
N-[(1R,3R,4S)-4-[[[3-(4-fluorophenyl)-2,2-dimethylpropyl]-methylamino]methyl]-3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexyl]-N-methylacetamide (PubChem CID 58997693) has the molecular formula C27H40FN5O2S and a molecular weight of 517.72 g/mol. Its IUPAC name is N-[(1R,3R,4S)-4-[[[3-(4-fluorophenyl)-2,2-dimethylpropyl]-methylamino]methyl]-3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexyl]-N-methylacetamide.
| Compound Name | N-[(1R,3R,4S)-4-[[[3-(4-fluorophenyl)-2,2-dimethylpropyl]-methylamino]methyl]-3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexyl]-N-methylacetamide |
|---|---|
| PubChem CID | 58997693 |
| Molecular Formula | C27H40FN5O2S |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | N-[(1R,3R,4S)-4-[[[3-(4-fluorophenyl)-2,2-dimethylpropyl]-methylamino]methyl]-3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)[C@@H]1CC[C@@H](CN(C)CC(C)(C)Cc2ccc(F)cc2)[C@H](NC(=O)Nc2nc(C)cs2)C1 |
| InChI | InChI=1S/C27H40FN5O2S/c1-18-16-36-26(29-18)31-25(35)30-24-13-23(33(6)19(2)34)12-9-21(24)15-32(5)17-27(3,4)14-20-7-10-22(28)11-8-20/h7-8,10-11,16,21,23-24H,9,12-15,17H2,1-6H3,(H2,29,30,31,35)/t21-,23+,24+/m0/s1 |
| InChIKey | GXJGRBNLDUPZTG-QPTUXGOLSA-N |
| XLogP | 4.93 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |