About chloro(dihydrido)iridium;2-(2-dipropylphosphaniumylethylamino)ethyl-dipropylphosphanium
chloro(dihydrido)iridium;2-(2-dipropylphosphaniumylethylamino)ethyl-dipropylphosphanium (PubChem CID 58997743) has the molecular formula C16H39ClIrNP2+2
and a molecular weight of 535.11 g/mol. Its IUPAC name is chloro(dihydrido)iridium;2-(2-dipropylphosphaniumylethylamino)ethyl-dipropylphosphanium.
Molecular Properties
| Compound Name | chloro(dihydrido)iridium;2-(2-dipropylphosphaniumylethylamino)ethyl-dipropylphosphanium |
| PubChem CID | 58997743 |
| Molecular Formula | C16H39ClIrNP2+2 |
| Molecular Weight | 535.11 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | chloro(dihydrido)iridium;2-(2-dipropylphosphaniumylethylamino)ethyl-dipropylphosphanium |
| SMILES | CCC[PH+](CCC)CCNCC[PH+](CCC)CCC.Cl[Ir] |
| InChI | InChI=1S/C16H37NP2.ClH.Ir/c1-5-11-18(12-6-2)15-9-17-10-16-19(13-7-3)14-8-4;;/h17H,5-16H2,1-4H3;1H;/q;;+1/p+1 |
| InChIKey | PNVPLTXJHJPNSG-UHFFFAOYSA-O |
| XLogP | 5.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.11 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloro(dihydrido)iridium;2-(2-dipropylphosphaniumylethylamino)ethyl-dipropylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(dihydrido)iridium;2-(2-dipropylphosphaniumylethylamino)ethyl-dipropylphosphanium?
The IUPAC name of chloro(dihydrido)iridium;2-(2-dipropylphosphaniumylethylamino)ethyl-dipropylphosphanium (CID 58997743) is chloro(dihydrido)iridium;2-(2-dipropylphosphaniumylethylamino)ethyl-dipropylphosphanium.
What is the SMILES notation for chloro(dihydrido)iridium;2-(2-dipropylphosphaniumylethylamino)ethyl-dipropylphosphanium?
The canonical SMILES for chloro(dihydrido)iridium;2-(2-dipropylphosphaniumylethylamino)ethyl-dipropylphosphanium is CCC[PH+](CCC)CCNCC[PH+](CCC)CCC.Cl[Ir].
What is the InChIKey of chloro(dihydrido)iridium;2-(2-dipropylphosphaniumylethylamino)ethyl-dipropylphosphanium?
The InChIKey is PNVPLTXJHJPNSG-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H37NP2.ClH.Ir/c1-5-11-18(12-6-2)15-9-17-10-16-19(13-7-3)14-8-4;;/h17H,5-16H2,1-4H3;1H;/q;;+1/p+1.
What are the key properties of chloro(dihydrido)iridium;2-(2-dipropylphosphaniumylethylamino)ethyl-dipropylphosphanium?
chloro(dihydrido)iridium;2-(2-dipropylphosphaniumylethylamino)ethyl-dipropylphosphanium has a molecular weight of 535.11 g/mol, XLogP of 5.33, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(dihydrido)iridium;2-(2-dipropylphosphaniumylethylamino)ethyl-dipropylphosphanium is sourced from PubChem (CID 58997743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).