C17H37Cl2NSiTi-2 — CID 58997873
tert-butyl-[ethyl-methyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorotitanium (PubChem CID 58997873) has the molecular formula C17H37Cl2NSiTi-2 and a molecular weight of 402.35 g/mol. Its IUPAC name is tert-butyl-[ethyl-methyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorotitanium.
| Compound Name | tert-butyl-[ethyl-methyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 58997873 |
| Molecular Formula | C17H37Cl2NSiTi-2 |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | tert-butyl-[ethyl-methyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorotitanium |
| SMILES | CC[Si](C)([N-]C(C)(C)C)C1C(C)C(C)C(C)C1C.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C16H34NSi.CH3.2ClH.Ti/c1-10-18(9,17-16(6,7)8)15-13(4)11(2)12(3)14(15)5;;;;/h11-15H,10H2,1-9H3;1H3;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | MQWSAYILPRWNIY-UHFFFAOYSA-L |
| XLogP | 7.51 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|