C17H37Cl2NSiTi-2 — CID 58997878
carbanide;dichlorotitanium;[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]-(2-methylbutan-2-yl)azanide (PubChem CID 58997878) has the molecular formula C17H37Cl2NSiTi-2 and a molecular weight of 402.35 g/mol. Its IUPAC name is carbanide;dichlorotitanium;[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]-(2-methylbutan-2-yl)azanide.
| Compound Name | carbanide;dichlorotitanium;[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]-(2-methylbutan-2-yl)azanide |
|---|---|
| PubChem CID | 58997878 |
| Molecular Formula | C17H37Cl2NSiTi-2 |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | carbanide;dichlorotitanium;[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]-(2-methylbutan-2-yl)azanide |
| SMILES | CCC(C)(C)[N-][Si](C)(C)C1C(C)C(C)C(C)C1C.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C16H34NSi.CH3.2ClH.Ti/c1-10-16(6,7)17-18(8,9)15-13(4)11(2)12(3)14(15)5;;;;/h11-15H,10H2,1-9H3;1H3;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | QMGZFVPCSWGTFJ-UHFFFAOYSA-L |
| XLogP | 7.51 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|