C9H16N3+ — CID 58997902
5-but-3-enyl-1,3,4-trimethyl-1,2,4-triazol-4-ium (PubChem CID 58997902) has the molecular formula C9H16N3+ and a molecular weight of 166.25 g/mol. Its IUPAC name is 5-but-3-enyl-1,3,4-trimethyl-1,2,4-triazol-4-ium.
| Compound Name | 5-but-3-enyl-1,3,4-trimethyl-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 58997902 |
| Molecular Formula | C9H16N3+ |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.13 |
| IUPAC Name | 5-but-3-enyl-1,3,4-trimethyl-1,2,4-triazol-4-ium |
| SMILES | C=CCCc1n(C)nc(C)[n+]1C |
| InChI | InChI=1S/C9H16N3/c1-5-6-7-9-11(3)8(2)10-12(9)4/h5H,1,6-7H2,2-4H3/q+1 |
| InChIKey | JFQMMARATGCBOE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|