C18H16FNO4 — CID 58997959
methyl (3S,4R)-8-fluoro-3-hydroxy-2-oxo-4-phenyl-4,5-dihydro-1H-1-benzazepine-3-carboxylate (PubChem CID 58997959) has the molecular formula C18H16FNO4 and a molecular weight of 329.33 g/mol. Its IUPAC name is methyl (3S,4R)-8-fluoro-3-hydroxy-2-oxo-4-phenyl-4,5-dihydro-1H-1-benzazepine-3-carboxylate.
| Compound Name | methyl (3S,4R)-8-fluoro-3-hydroxy-2-oxo-4-phenyl-4,5-dihydro-1H-1-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 58997959 |
| Molecular Formula | C18H16FNO4 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | methyl (3S,4R)-8-fluoro-3-hydroxy-2-oxo-4-phenyl-4,5-dihydro-1H-1-benzazepine-3-carboxylate |
| SMILES | COC(=O)[C@@]1(O)C(=O)Nc2cc(F)ccc2C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H16FNO4/c1-24-17(22)18(23)14(11-5-3-2-4-6-11)9-12-7-8-13(19)10-15(12)20-16(18)21/h2-8,10,14,23H,9H2,1H3,(H,20,21)/t14-,18+/m1/s1 |
| InChIKey | GAGWDSCWOOSFSZ-KDOFPFPSSA-N |
| XLogP | 2.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|