About CID 58998271
CID 58998271 (PubChem CID 58998271) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol.
Molecular Properties
| Compound Name | CID 58998271 |
| PubChem CID | 58998271 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | — |
| SMILES | [CH]N1CCC(O)CC1 |
| InChI | InChI=1S/C6H11NO/c1-7-4-2-6(8)3-5-7/h1,6,8H,2-5H2 |
| InChIKey | PBHLBZBJQIAKIG-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 58998271 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58998271?
The IUPAC name of CID 58998271 (CID 58998271) is not available.
What is the SMILES notation for CID 58998271?
The canonical SMILES for CID 58998271 is [CH]N1CCC(O)CC1.
What is the InChIKey of CID 58998271?
The InChIKey is PBHLBZBJQIAKIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-7-4-2-6(8)3-5-7/h1,6,8H,2-5H2.
What are the key properties of CID 58998271?
CID 58998271 has a molecular weight of 113.16 g/mol, XLogP of 0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58998271 is sourced from PubChem (CID 58998271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).