C25H26ClF2N3O2 — CID 58998604
N-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-6-chloro-N-[(3-ethylphenyl)methyl]pyridine-3-carboxamide (PubChem CID 58998604) has the molecular formula C25H26ClF2N3O2 and a molecular weight of 473.95 g/mol. Its IUPAC name is N-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-6-chloro-N-[(3-ethylphenyl)methyl]pyridine-3-carboxamide.
| Compound Name | N-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-6-chloro-N-[(3-ethylphenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58998604 |
| Molecular Formula | C25H26ClF2N3O2 |
| Molecular Weight | 473.95 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | N-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-6-chloro-N-[(3-ethylphenyl)methyl]pyridine-3-carboxamide |
| SMILES | CCc1cccc(CN(C[C@@H](O)[C@@H](N)Cc2cc(F)cc(F)c2)C(=O)c2ccc(Cl)nc2)c1 |
| InChI | InChI=1S/C25H26ClF2N3O2/c1-2-16-4-3-5-17(8-16)14-31(25(33)19-6-7-24(26)30-13-19)15-23(32)22(29)11-18-9-20(27)12-21(28)10-18/h3-10,12-13,22-23,32H,2,11,14-15,29H2,1H3/t22-,23+/m0/s1 |
| InChIKey | CTDQIANJNIVPOM-XZOQPEGZSA-N |
| XLogP | 4.15 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.95 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|