C15H20PY- — CID 58999312
4-ethyl-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]isophosphinoline;yttrium (PubChem CID 58999312) has the molecular formula C15H20PY- and a molecular weight of 320.20 g/mol. Its IUPAC name is 4-ethyl-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]isophosphinoline;yttrium.
| Compound Name | 4-ethyl-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]isophosphinoline;yttrium |
|---|---|
| PubChem CID | 58999312 |
| Molecular Formula | C15H20PY- |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 4-ethyl-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]isophosphinoline;yttrium |
| SMILES | [CH2-]CC1PCCC2c3ccccc3CCC12.[Y] |
| InChI | InChI=1S/C15H20P.Y/c1-2-15-14-8-7-11-5-3-4-6-12(11)13(14)9-10-16-15;/h3-6,13-16H,1-2,7-10H2;/q-1; |
| InChIKey | BGUSBUIXBLPHAU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|