About (4-nitrophenyl) N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamate
(4-nitrophenyl) N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamate (PubChem CID 58999327) has the molecular formula C27H16N2O9
and a molecular weight of 512.43 g/mol. Its IUPAC name is (4-nitrophenyl) N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamate.
Molecular Properties
| Compound Name | (4-nitrophenyl) N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamate |
| PubChem CID | 58999327 |
| Molecular Formula | C27H16N2O9 |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | (4-nitrophenyl) N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamate |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H16N2O9/c30-16-4-9-21-23(12-16)37-24-13-17(31)5-10-22(24)27(21)20-8-1-14(11-19(20)25(32)38-27)28-26(33)36-18-6-2-15(3-7-18)29(34)35/h1-13,30-31H,(H,28,33) |
| InChIKey | KEBWEJWTPLRYOB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 157.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamate?
The IUPAC name of (4-nitrophenyl) N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamate (CID 58999327) is (4-nitrophenyl) N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamate.
What is the SMILES notation for (4-nitrophenyl) N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamate?
The canonical SMILES for (4-nitrophenyl) N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamate is O=C(Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl) N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamate?
The InChIKey is KEBWEJWTPLRYOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H16N2O9/c30-16-4-9-21-23(12-16)37-24-13-17(31)5-10-22(24)27(21)20-8-1-14(11-19(20)25(32)38-27)28-26(33)36-18-6-2-15(3-7-18)29(34)35/h1-13,30-31H,(H,28,33).
What are the key properties of (4-nitrophenyl) N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamate?
(4-nitrophenyl) N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamate has a molecular weight of 512.43 g/mol, XLogP of 5.18, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamate is sourced from PubChem (CID 58999327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).