About CID 58999337
CID 58999337 (PubChem CID 58999337) has the molecular formula C28H37NO5Si2
and a molecular weight of 523.78 g/mol.
Molecular Properties
| Compound Name | CID 58999337 |
| PubChem CID | 58999337 |
| Molecular Formula | C28H37NO5Si2 |
| Molecular Weight | 523.78 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)OCCC[Si]O[Si](CCCOCCN1CCCC1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H37NO5Si2/c1-24(2)28(31)33-20-10-22-35-34-36(25-12-5-3-6-13-25,26-14-7-4-8-15-26)23-11-19-32-21-18-29-17-9-16-27(29)30/h3-8,12-15H,1,9-11,16-23H2,2H3 |
| InChIKey | ITCOSCLNYNIXDW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 523.78 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 58999337 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58999337?
The IUPAC name of CID 58999337 (CID 58999337) is not available.
What is the SMILES notation for CID 58999337?
The canonical SMILES for CID 58999337 is C=C(C)C(=O)OCCC[Si]O[Si](CCCOCCN1CCCC1=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 58999337?
The InChIKey is ITCOSCLNYNIXDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H37NO5Si2/c1-24(2)28(31)33-20-10-22-35-34-36(25-12-5-3-6-13-25,26-14-7-4-8-15-26)23-11-19-32-21-18-29-17-9-16-27(29)30/h3-8,12-15H,1,9-11,16-23H2,2H3.
What are the key properties of CID 58999337?
CID 58999337 has a molecular weight of 523.78 g/mol, XLogP of 3.34, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58999337 is sourced from PubChem (CID 58999337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).