C11H12N3OY- — CID 58999609
2-(azidomethyl)-7-methyl-2,3,4,8-tetrahydrochromen-8-ide;yttrium (PubChem CID 58999609) has the molecular formula C11H12N3OY- and a molecular weight of 291.14 g/mol. Its IUPAC name is 2-(azidomethyl)-7-methyl-2,3,4,8-tetrahydrochromen-8-ide;yttrium.
| Compound Name | 2-(azidomethyl)-7-methyl-2,3,4,8-tetrahydrochromen-8-ide;yttrium |
|---|---|
| PubChem CID | 58999609 |
| Molecular Formula | C11H12N3OY- |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 2-(azidomethyl)-7-methyl-2,3,4,8-tetrahydrochromen-8-ide;yttrium |
| SMILES | Cc1[c-]c2c(cc1)CCC(CN=[N+]=[N-])O2.[Y] |
| InChI | InChI=1S/C11H12N3O.Y/c1-8-2-3-9-4-5-10(7-13-14-12)15-11(9)6-8;/h2-3,10H,4-5,7H2,1H3;/q-1; |
| InChIKey | SYMWNGQYMFENFM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|