C31H43FN2O7 — CID 58999692
tert-butyl (3S)-3-[[(2S)-3-cyclopentyl-2-[[5-(3-fluorophenyl)furan-2-carbonyl]amino]propanoyl]amino]-4,4-diethoxybutanoate (PubChem CID 58999692) has the molecular formula C31H43FN2O7 and a molecular weight of 574.69 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[(2S)-3-cyclopentyl-2-[[5-(3-fluorophenyl)furan-2-carbonyl]amino]propanoyl]amino]-4,4-diethoxybutanoate.
| Compound Name | tert-butyl (3S)-3-[[(2S)-3-cyclopentyl-2-[[5-(3-fluorophenyl)furan-2-carbonyl]amino]propanoyl]amino]-4,4-diethoxybutanoate |
|---|---|
| PubChem CID | 58999692 |
| Molecular Formula | C31H43FN2O7 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | tert-butyl (3S)-3-[[(2S)-3-cyclopentyl-2-[[5-(3-fluorophenyl)furan-2-carbonyl]amino]propanoyl]amino]-4,4-diethoxybutanoate |
| SMILES | CCOC(OCC)[C@H](CC(=O)OC(C)(C)C)NC(=O)[C@H](CC1CCCC1)NC(=O)c1ccc(-c2cccc(F)c2)o1 |
| InChI | InChI=1S/C31H43FN2O7/c1-6-38-30(39-7-2)24(19-27(35)41-31(3,4)5)34-28(36)23(17-20-11-8-9-12-20)33-29(37)26-16-15-25(40-26)21-13-10-14-22(32)18-21/h10,13-16,18,20,23-24,30H,6-9,11-12,17,19H2,1-5H3,(H,33,37)(H,34,36)/t23-,24-/m0/s1 |
| InChIKey | ZWNBCRXZSCLMLT-ZEQRLZLVSA-N |
| XLogP | 5.38 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|