C21H29NO5Si — CID 58999748
(4R,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-1-phenylmethoxy-1-azaspiro[3.5]non-8-ene-2,7-dione (PubChem CID 58999748) has the molecular formula C21H29NO5Si and a molecular weight of 403.55 g/mol. Its IUPAC name is (4R,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-1-phenylmethoxy-1-azaspiro[3.5]non-8-ene-2,7-dione.
| Compound Name | (4R,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-1-phenylmethoxy-1-azaspiro[3.5]non-8-ene-2,7-dione |
|---|---|
| PubChem CID | 58999748 |
| Molecular Formula | C21H29NO5Si |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (4R,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-1-phenylmethoxy-1-azaspiro[3.5]non-8-ene-2,7-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)C=C[C@]2(CC(=O)N2OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C21H29NO5Si/c1-20(2,3)28(4,5)27-18-16(23)11-12-21(19(18)25)13-17(24)22(21)26-14-15-9-7-6-8-10-15/h6-12,18-19,25H,13-14H2,1-5H3/t18-,19-,21+/m1/s1 |
| InChIKey | GDKWRIZLOXZBJH-SBHAEUEKSA-N |
| XLogP | 2.98 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|