C28H46N2O5Si3 — CID 58999758
(4R,5S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxo-1-phenylmethoxy-5,7-bis(trimethylsilyloxy)-1-azaspiro[3.5]non-8-ene-7-carbonitrile (PubChem CID 58999758) has the molecular formula C28H46N2O5Si3 and a molecular weight of 574.94 g/mol. Its IUPAC name is (4R,5S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxo-1-phenylmethoxy-5,7-bis(trimethylsilyloxy)-1-azaspiro[3.5]non-8-ene-7-carbonitrile.
| Compound Name | (4R,5S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxo-1-phenylmethoxy-5,7-bis(trimethylsilyloxy)-1-azaspiro[3.5]non-8-ene-7-carbonitrile |
|---|---|
| PubChem CID | 58999758 |
| Molecular Formula | C28H46N2O5Si3 |
| Molecular Weight | 574.94 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | (4R,5S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxo-1-phenylmethoxy-5,7-bis(trimethylsilyloxy)-1-azaspiro[3.5]non-8-ene-7-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@]2(C=C[C@]1(C#N)O[Si](C)(C)C)CC(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C28H46N2O5Si3/c1-26(2,3)38(10,11)34-25-24(33-36(4,5)6)27(17-18-28(25,21-29)35-37(7,8)9)19-23(31)30(27)32-20-22-15-13-12-14-16-22/h12-18,24-25H,19-20H2,1-11H3/t24-,25+,27+,28-/m1/s1 |
| InChIKey | CNLFHBCNJNALOP-JWNHKAHSSA-N |
| XLogP | 6.38 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.94 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|