C25H40N2O5Si3 — CID 58999770
(4R,5S,6S,7R)-2-oxo-1-phenylmethoxy-5,6,7-tris(trimethylsilyloxy)-1-azaspiro[3.5]non-8-ene-7-carbonitrile (PubChem CID 58999770) has the molecular formula C25H40N2O5Si3 and a molecular weight of 532.86 g/mol. Its IUPAC name is (4R,5S,6S,7R)-2-oxo-1-phenylmethoxy-5,6,7-tris(trimethylsilyloxy)-1-azaspiro[3.5]non-8-ene-7-carbonitrile.
| Compound Name | (4R,5S,6S,7R)-2-oxo-1-phenylmethoxy-5,6,7-tris(trimethylsilyloxy)-1-azaspiro[3.5]non-8-ene-7-carbonitrile |
|---|---|
| PubChem CID | 58999770 |
| Molecular Formula | C25H40N2O5Si3 |
| Molecular Weight | 532.86 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | (4R,5S,6S,7R)-2-oxo-1-phenylmethoxy-5,6,7-tris(trimethylsilyloxy)-1-azaspiro[3.5]non-8-ene-7-carbonitrile |
| SMILES | C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@](C#N)(O[Si](C)(C)C)C=C[C@]12CC(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C25H40N2O5Si3/c1-33(2,3)30-22-23(31-34(4,5)6)25(19-26,32-35(7,8)9)16-15-24(22)17-21(28)27(24)29-18-20-13-11-10-12-14-20/h10-16,22-23H,17-18H2,1-9H3/t22-,23+,24+,25-/m1/s1 |
| InChIKey | SCSKNPHSTVLRCN-WSOYEBOPSA-N |
| XLogP | 5.21 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.86 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|