C12H19I — CID 58999816
(Z,3R,4R,5R)-4-ethyl-7-iodo-3,5-dimethyloct-6-en-1-yne (PubChem CID 58999816) has the molecular formula C12H19I and a molecular weight of 290.19 g/mol. Its IUPAC name is (Z,3R,4R,5R)-4-ethyl-7-iodo-3,5-dimethyloct-6-en-1-yne.
| Compound Name | (Z,3R,4R,5R)-4-ethyl-7-iodo-3,5-dimethyloct-6-en-1-yne |
|---|---|
| PubChem CID | 58999816 |
| Molecular Formula | C12H19I |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | (Z,3R,4R,5R)-4-ethyl-7-iodo-3,5-dimethyloct-6-en-1-yne |
| SMILES | C#C[C@H](C)[C@H](CC)[C@@H](C)/C=C(/C)I |
| InChI | InChI=1S/C12H19I/c1-6-9(3)12(7-2)10(4)8-11(5)13/h1,8-10,12H,7H2,2-5H3/b11-8-/t9-,10-,12-/m0/s1 |
| InChIKey | XYTRDMGSZZBJSW-LJEJOGRQSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|