C15H30O2 — CID 59000177
2,4,5-tritert-butyl-1,3-dioxolane (PubChem CID 59000177) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is 2,4,5-tritert-butyl-1,3-dioxolane.
| Compound Name | 2,4,5-tritert-butyl-1,3-dioxolane |
|---|---|
| PubChem CID | 59000177 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 2,4,5-tritert-butyl-1,3-dioxolane |
| SMILES | CC(C)(C)C1OC(C(C)(C)C)C(C(C)(C)C)O1 |
| InChI | InChI=1S/C15H30O2/c1-13(2,3)10-11(14(4,5)6)17-12(16-10)15(7,8)9/h10-12H,1-9H3 |
| InChIKey | QBOMCDSHQHRTOJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |