C21H16N2O2S — CID 59000382
(4E)-4-[(E,4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)but-2-enylidene]-3-phenyl-1,2-oxazol-5-one (PubChem CID 59000382) has the molecular formula C21H16N2O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is (4E)-4-[(E,4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)but-2-enylidene]-3-phenyl-1,2-oxazol-5-one.
| Compound Name | (4E)-4-[(E,4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)but-2-enylidene]-3-phenyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 59000382 |
| Molecular Formula | C21H16N2O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | (4E)-4-[(E,4Z)-4-(3-methyl-1,3-benzothiazol-2-ylidene)but-2-enylidene]-3-phenyl-1,2-oxazol-5-one |
| SMILES | CN1/C(=C/C=C/C=C2/C(=O)ON=C2c2ccccc2)Sc2ccccc21 |
| InChI | InChI=1S/C21H16N2O2S/c1-23-17-12-6-7-13-18(17)26-19(23)14-8-5-11-16-20(22-25-21(16)24)15-9-3-2-4-10-15/h2-14H,1H3/b8-5+,16-11+,19-14- |
| InChIKey | FNNASILXWPVZBN-WCLSPOPMSA-N |
| XLogP | 4.51 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|