About pentyl 3-[4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate
pentyl 3-[4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate (PubChem CID 59001659) has the molecular formula C27H31F5O4S
and a molecular weight of 546.60 g/mol. Its IUPAC name is pentyl 3-[4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate.
Molecular Properties
| Compound Name | pentyl 3-[4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate |
| PubChem CID | 59001659 |
| Molecular Formula | C27H31F5O4S |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | pentyl 3-[4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate |
| SMILES | CCCCCOC(=O)CCC1CCC(c2cc(F)ccc2F)(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C27H31F5O4S/c1-2-3-4-17-36-25(33)12-5-19-13-15-26(16-14-19,23-18-21(28)8-11-24(23)29)37(34,35)22-9-6-20(7-10-22)27(30,31)32/h6-11,18-19H,2-5,12-17H2,1H3 |
| InChIKey | KRQVZYSSPACMPA-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentyl 3-[4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl 3-[4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate?
The IUPAC name of pentyl 3-[4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate (CID 59001659) is pentyl 3-[4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate.
What is the SMILES notation for pentyl 3-[4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate?
The canonical SMILES for pentyl 3-[4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate is CCCCCOC(=O)CCC1CCC(c2cc(F)ccc2F)(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1.
What is the InChIKey of pentyl 3-[4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate?
The InChIKey is KRQVZYSSPACMPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31F5O4S/c1-2-3-4-17-36-25(33)12-5-19-13-15-26(16-14-19,23-18-21(28)8-11-24(23)29)37(34,35)22-9-6-20(7-10-22)27(30,31)32/h6-11,18-19H,2-5,12-17H2,1H3.
What are the key properties of pentyl 3-[4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate?
pentyl 3-[4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate has a molecular weight of 546.60 g/mol, XLogP of 7.36, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 3-[4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate is sourced from PubChem (CID 59001659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).