C34H28N6 — CID 59002233
2-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-4,6-bis(4-methylphenyl)-1,3,5-triazine (PubChem CID 59002233) has the molecular formula C34H28N6 and a molecular weight of 520.64 g/mol. Its IUPAC name is 2-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-4,6-bis(4-methylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-4,6-bis(4-methylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 59002233 |
| Molecular Formula | C34H28N6 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 2-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-4,6-bis(4-methylphenyl)-1,3,5-triazine |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3)nc(-c3nc(-c4ccc(C)cc4)nc(-c4ccc(C)cc4)n3)n2)cc1 |
| InChI | InChI=1S/C34H28N6/c1-21-5-13-25(14-6-21)29-35-30(26-15-7-22(2)8-16-26)38-33(37-29)34-39-31(27-17-9-23(3)10-18-27)36-32(40-34)28-19-11-24(4)12-20-28/h5-20H,1-4H3 |
| InChIKey | JRFNVLWDSIZMPM-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |