C21H26F12O7 — CID 59002295
6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonyl)-4-(2-hydroxyethoxycarbonyl)-2,4-dimethyloctanoic acid (PubChem CID 59002295) has the molecular formula C21H26F12O7 and a molecular weight of 618.41 g/mol. Its IUPAC name is 6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonyl)-4-(2-hydroxyethoxycarbonyl)-2,4-dimethyloctanoic acid.
| Compound Name | 6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonyl)-4-(2-hydroxyethoxycarbonyl)-2,4-dimethyloctanoic acid |
|---|---|
| PubChem CID | 59002295 |
| Molecular Formula | C21H26F12O7 |
| Molecular Weight | 618.41 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | 6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonyl)-4-(2-hydroxyethoxycarbonyl)-2,4-dimethyloctanoic acid |
| SMILES | CCC(CC(C)(CC(C)C(=O)O)C(=O)OCCO)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C21H26F12O7/c1-4-11(8-16(3,7-10(2)12(35)36)15(38)39-6-5-34)13(37)40-9-17(24,25)19(28,29)21(32,33)20(30,31)18(26,27)14(22)23/h10-11,14,34H,4-9H2,1-3H3,(H,35,36) |
| InChIKey | XAPDNKWMBIJUAF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|