C21H25ClN7O3+ — CID 59002317
2-amino-6-chloro-9-[(1-hydroxy-4-methoxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]-7-(3-pyrrol-1-ylpropyl)purin-8-one (PubChem CID 59002317) has the molecular formula C21H25ClN7O3+ and a molecular weight of 458.93 g/mol. Its IUPAC name is 2-amino-6-chloro-9-[(1-hydroxy-4-methoxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]-7-(3-pyrrol-1-ylpropyl)purin-8-one.
| Compound Name | 2-amino-6-chloro-9-[(1-hydroxy-4-methoxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]-7-(3-pyrrol-1-ylpropyl)purin-8-one |
|---|---|
| PubChem CID | 59002317 |
| Molecular Formula | C21H25ClN7O3+ |
| Molecular Weight | 458.93 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-amino-6-chloro-9-[(1-hydroxy-4-methoxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]-7-(3-pyrrol-1-ylpropyl)purin-8-one |
| SMILES | COc1c(C)c[n+](O)c(Cn2c(=O)n(CCCn3cccc3)c3c(Cl)nc(N)nc32)c1C |
| InChI | InChI=1S/C21H25ClN7O3/c1-13-11-29(31)15(14(2)17(13)32-3)12-28-19-16(18(22)24-20(23)25-19)27(21(28)30)10-6-9-26-7-4-5-8-26/h4-5,7-8,11,31H,6,9-10,12H2,1-3H3,(H2,23,24,25)/q+1 |
| InChIKey | RYQWYQKQSOOOER-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.93 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|