About methyl 4-[(1-methylpyrazolo[3,4-b]quinolin-4-yl)amino]benzoate
methyl 4-[(1-methylpyrazolo[3,4-b]quinolin-4-yl)amino]benzoate (PubChem CID 59002401) has the molecular formula C19H16N4O2
and a molecular weight of 332.36 g/mol. Its IUPAC name is methyl 4-[(1-methylpyrazolo[3,4-b]quinolin-4-yl)amino]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(1-methylpyrazolo[3,4-b]quinolin-4-yl)amino]benzoate |
| PubChem CID | 59002401 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | methyl 4-[(1-methylpyrazolo[3,4-b]quinolin-4-yl)amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2c3ccccc3nc3c2cnn3C)cc1 |
| InChI | InChI=1S/C19H16N4O2/c1-23-18-15(11-20-23)17(14-5-3-4-6-16(14)22-18)21-13-9-7-12(8-10-13)19(24)25-2/h3-11H,1-2H3,(H,21,22) |
| InChIKey | XOKHPOSJGYPIGE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[(1-methylpyrazolo[3,4-b]quinolin-4-yl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(1-methylpyrazolo[3,4-b]quinolin-4-yl)amino]benzoate?
The IUPAC name of methyl 4-[(1-methylpyrazolo[3,4-b]quinolin-4-yl)amino]benzoate (CID 59002401) is methyl 4-[(1-methylpyrazolo[3,4-b]quinolin-4-yl)amino]benzoate.
What is the SMILES notation for methyl 4-[(1-methylpyrazolo[3,4-b]quinolin-4-yl)amino]benzoate?
The canonical SMILES for methyl 4-[(1-methylpyrazolo[3,4-b]quinolin-4-yl)amino]benzoate is COC(=O)c1ccc(Nc2c3ccccc3nc3c2cnn3C)cc1.
What is the InChIKey of methyl 4-[(1-methylpyrazolo[3,4-b]quinolin-4-yl)amino]benzoate?
The InChIKey is XOKHPOSJGYPIGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O2/c1-23-18-15(11-20-23)17(14-5-3-4-6-16(14)22-18)21-13-9-7-12(8-10-13)19(24)25-2/h3-11H,1-2H3,(H,21,22).
What are the key properties of methyl 4-[(1-methylpyrazolo[3,4-b]quinolin-4-yl)amino]benzoate?
methyl 4-[(1-methylpyrazolo[3,4-b]quinolin-4-yl)amino]benzoate has a molecular weight of 332.36 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(1-methylpyrazolo[3,4-b]quinolin-4-yl)amino]benzoate is sourced from PubChem (CID 59002401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).