C19H24F12O5 — CID 59002504
1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-O-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2-ethyl-2,4,4-trimethylpentanedioate (PubChem CID 59002504) has the molecular formula C19H24F12O5 and a molecular weight of 560.37 g/mol. Its IUPAC name is 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-O-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2-ethyl-2,4,4-trimethylpentanedioate.
| Compound Name | 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-O-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2-ethyl-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 59002504 |
| Molecular Formula | C19H24F12O5 |
| Molecular Weight | 560.37 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-O-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2-ethyl-2,4,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OC(C)CC(O)(C(F)(F)F)C(F)(F)F)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H24F12O5/c1-6-14(5,12(33)36-10(16(20,21)22)17(23,24)25)8-13(3,4)11(32)35-9(2)7-15(34,18(26,27)28)19(29,30)31/h9-10,34H,6-8H2,1-5H3 |
| InChIKey | IDNMEOPUKOKBHF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.37 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |