C18H22F12O4 — CID 59002506
4-[2-(difluoromethyl)-3,3,4,4,5,5,6,6,7,7-decafluoroheptoxy]carbonyl-2,2,4-trimethylhexanoic acid (PubChem CID 59002506) has the molecular formula C18H22F12O4 and a molecular weight of 530.35 g/mol. Its IUPAC name is 4-[2-(difluoromethyl)-3,3,4,4,5,5,6,6,7,7-decafluoroheptoxy]carbonyl-2,2,4-trimethylhexanoic acid.
| Compound Name | 4-[2-(difluoromethyl)-3,3,4,4,5,5,6,6,7,7-decafluoroheptoxy]carbonyl-2,2,4-trimethylhexanoic acid |
|---|---|
| PubChem CID | 59002506 |
| Molecular Formula | C18H22F12O4 |
| Molecular Weight | 530.35 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 4-[2-(difluoromethyl)-3,3,4,4,5,5,6,6,7,7-decafluoroheptoxy]carbonyl-2,2,4-trimethylhexanoic acid |
| SMILES | CCC(C)(CC(C)(C)C(=O)O)C(=O)OCC(C(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C18H22F12O4/c1-5-14(4,7-13(2,3)11(31)32)12(33)34-6-8(9(19)20)15(23,24)17(27,28)18(29,30)16(25,26)10(21)22/h8-10H,5-7H2,1-4H3,(H,31,32) |
| InChIKey | XLZRNMYWIKFYGX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.35 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|