C17H21F7O4 — CID 59002507
4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-methyl-3-(3-methyl-2-bicyclo[2.2.1]heptanyl)-4-oxobutanoic acid (PubChem CID 59002507) has the molecular formula C17H21F7O4 and a molecular weight of 422.34 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-methyl-3-(3-methyl-2-bicyclo[2.2.1]heptanyl)-4-oxobutanoic acid.
| Compound Name | 4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-methyl-3-(3-methyl-2-bicyclo[2.2.1]heptanyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59002507 |
| Molecular Formula | C17H21F7O4 |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-methyl-3-(3-methyl-2-bicyclo[2.2.1]heptanyl)-4-oxobutanoic acid |
| SMILES | CC(C(=O)O)C(C(=O)OCC(F)(F)C(F)(F)C(F)(F)F)C1C2CCC(C2)C1C |
| InChI | InChI=1S/C17H21F7O4/c1-7-9-3-4-10(5-9)11(7)12(8(2)13(25)26)14(27)28-6-15(18,19)16(20,21)17(22,23)24/h7-12H,3-6H2,1-2H3,(H,25,26) |
| InChIKey | KORPUQOMFXZHLN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|