C15H21F7O4 — CID 59002515
2-ethyl-4-(2,2,3,3,4,4,4-heptafluorobutoxycarbonyl)-2,4-dimethylhexanoic acid (PubChem CID 59002515) has the molecular formula C15H21F7O4 and a molecular weight of 398.32 g/mol. Its IUPAC name is 2-ethyl-4-(2,2,3,3,4,4,4-heptafluorobutoxycarbonyl)-2,4-dimethylhexanoic acid.
| Compound Name | 2-ethyl-4-(2,2,3,3,4,4,4-heptafluorobutoxycarbonyl)-2,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 59002515 |
| Molecular Formula | C15H21F7O4 |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-ethyl-4-(2,2,3,3,4,4,4-heptafluorobutoxycarbonyl)-2,4-dimethylhexanoic acid |
| SMILES | CCC(C)(CC(C)(CC)C(=O)OCC(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C15H21F7O4/c1-5-11(3,9(23)24)7-12(4,6-2)10(25)26-8-13(16,17)14(18,19)15(20,21)22/h5-8H2,1-4H3,(H,23,24) |
| InChIKey | WLEWCSIVXTYNDQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|