About tert-butyl [(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] carbonate
tert-butyl [(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] carbonate (PubChem CID 59002621) has the molecular formula C18H32O5Si
and a molecular weight of 356.54 g/mol. Its IUPAC name is tert-butyl [(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] carbonate.
Molecular Properties
| Compound Name | tert-butyl [(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] carbonate |
| PubChem CID | 59002621 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | tert-butyl [(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)O[C@@H]1C=CC(=O)[C@@H](CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C18H32O5Si/c1-17(2,3)23-16(20)22-14-9-10-15(19)13(11-14)12-21-24(7,8)18(4,5)6/h9-10,13-14H,11-12H2,1-8H3/t13-,14-/m1/s1 |
| InChIKey | OXYOWQJEBSBPMV-ZIAGYGMSSA-N |
| XLogP | 4.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl [(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl [(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] carbonate?
The IUPAC name of tert-butyl [(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] carbonate (CID 59002621) is tert-butyl [(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] carbonate.
What is the SMILES notation for tert-butyl [(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] carbonate?
The canonical SMILES for tert-butyl [(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] carbonate is CC(C)(C)OC(=O)O[C@@H]1C=CC(=O)[C@@H](CO[Si](C)(C)C(C)(C)C)C1.
What is the InChIKey of tert-butyl [(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] carbonate?
The InChIKey is OXYOWQJEBSBPMV-ZIAGYGMSSA-N. The full InChI is InChI=1S/C18H32O5Si/c1-17(2,3)23-16(20)22-14-9-10-15(19)13(11-14)12-21-24(7,8)18(4,5)6/h9-10,13-14H,11-12H2,1-8H3/t13-,14-/m1/s1.
What are the key properties of tert-butyl [(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] carbonate?
tert-butyl [(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] carbonate has a molecular weight of 356.54 g/mol, XLogP of 4.47, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl [(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] carbonate is sourced from PubChem (CID 59002621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).