C32H54N8O9S2 — CID 59002762
2-[[2-[bis[3-[3-[3-[2-(cyclopropylamino)-2-oxoethyl]sulfanylpropanoylamino]propanoylamino]propyl]amino]acetyl]amino]acetic acid (PubChem CID 59002762) has the molecular formula C32H54N8O9S2 and a molecular weight of 758.96 g/mol. Its IUPAC name is 2-[[2-[bis[3-[3-[3-[2-(cyclopropylamino)-2-oxoethyl]sulfanylpropanoylamino]propanoylamino]propyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[bis[3-[3-[3-[2-(cyclopropylamino)-2-oxoethyl]sulfanylpropanoylamino]propanoylamino]propyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 59002762 |
| Molecular Formula | C32H54N8O9S2 |
| Molecular Weight | 758.96 g/mol |
| Exact Mass | 758.35 |
| IUPAC Name | 2-[[2-[bis[3-[3-[3-[2-(cyclopropylamino)-2-oxoethyl]sulfanylpropanoylamino]propanoylamino]propyl]amino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CN(CCCNC(=O)CCNC(=O)CCSCC(=O)NC1CC1)CCCNC(=O)CCNC(=O)CCSCC(=O)NC1CC1 |
| InChI | InChI=1S/C32H54N8O9S2/c41-25(7-13-35-27(43)9-17-50-21-30(46)38-23-3-4-23)33-11-1-15-40(20-29(45)37-19-32(48)49)16-2-12-34-26(42)8-14-36-28(44)10-18-51-22-31(47)39-24-5-6-24/h23-24H,1-22H2,(H,33,41)(H,34,42)(H,35,43)(H,36,44)(H,37,45)(H,38,46)(H,39,47)(H,48,49) |
| InChIKey | FMTGWYNYVYXFGQ-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 244.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.96 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|