C30H44N6O14 — CID 59002806
N',N'-bis[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-hydroperoxyethyl)butanediamide (PubChem CID 59002806) has the molecular formula C30H44N6O14 and a molecular weight of 712.71 g/mol. Its IUPAC name is N',N'-bis[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-hydroperoxyethyl)butanediamide.
| Compound Name | N',N'-bis[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-hydroperoxyethyl)butanediamide |
|---|---|
| PubChem CID | 59002806 |
| Molecular Formula | C30H44N6O14 |
| Molecular Weight | 712.71 g/mol |
| Exact Mass | 712.29 |
| IUPAC Name | N',N'-bis[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-hydroperoxyethyl)butanediamide |
| SMILES | O=C(CCC(=O)N(CC(=O)NCCOCCOCCN1C(=O)C=CC1=O)CC(=O)NCCOCCOCCN1C(=O)C=CC1=O)NCCOO |
| InChI | InChI=1S/C30H44N6O14/c37-23(31-9-14-50-45)1-2-26(40)34(21-24(38)32-7-12-46-17-19-48-15-10-35-27(41)3-4-28(35)42)22-25(39)33-8-13-47-18-20-49-16-11-36-29(43)5-6-30(36)44/h3-6,45H,1-2,7-22H2,(H,31,37)(H,32,38)(H,33,39) |
| InChIKey | QUMBZKKTORVYDC-UHFFFAOYSA-N |
| XLogP | -3.65 |
| TPSA | 248.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.71 |
| LogP ≤ 5 | -3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|