C20H16F5NO3 — CID 59002947
ethyl 4-oxo-4-(2,3,4,5,6-pentafluorophenyl)-2-(2-phenylethylamino)but-2-enoate (PubChem CID 59002947) has the molecular formula C20H16F5NO3 and a molecular weight of 413.34 g/mol. Its IUPAC name is ethyl 4-oxo-4-(2,3,4,5,6-pentafluorophenyl)-2-(2-phenylethylamino)but-2-enoate.
| Compound Name | ethyl 4-oxo-4-(2,3,4,5,6-pentafluorophenyl)-2-(2-phenylethylamino)but-2-enoate |
|---|---|
| PubChem CID | 59002947 |
| Molecular Formula | C20H16F5NO3 |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | ethyl 4-oxo-4-(2,3,4,5,6-pentafluorophenyl)-2-(2-phenylethylamino)but-2-enoate |
| SMILES | CCOC(=O)C(=CC(=O)c1c(F)c(F)c(F)c(F)c1F)NCCc1ccccc1 |
| InChI | InChI=1S/C20H16F5NO3/c1-2-29-20(28)12(26-9-8-11-6-4-3-5-7-11)10-13(27)14-15(21)17(23)19(25)18(24)16(14)22/h3-7,10,26H,2,8-9H2,1H3 |
| InChIKey | FVBFLPJLSHYYDW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ester(24)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|