C29H26FN3O6 — CID 59003002
(2S)-8-amino-6-[[3-(1,3-benzodioxol-5-yl)-3-phenylpropyl]amino]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid (PubChem CID 59003002) has the molecular formula C29H26FN3O6 and a molecular weight of 531.54 g/mol. Its IUPAC name is (2S)-8-amino-6-[[3-(1,3-benzodioxol-5-yl)-3-phenylpropyl]amino]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid.
| Compound Name | (2S)-8-amino-6-[[3-(1,3-benzodioxol-5-yl)-3-phenylpropyl]amino]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 59003002 |
| Molecular Formula | C29H26FN3O6 |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | (2S)-8-amino-6-[[3-(1,3-benzodioxol-5-yl)-3-phenylpropyl]amino]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| SMILES | C[C@H]1COc2c(NCCC(c3ccccc3)c3ccc4c(c3)OCO4)c(F)c(N)c3c(=O)c(C(=O)O)cn1c23 |
| InChI | InChI=1S/C29H26FN3O6/c1-15-13-37-28-25(23(30)24(31)22-26(28)33(15)12-19(27(22)34)29(35)36)32-10-9-18(16-5-3-2-4-6-16)17-7-8-20-21(11-17)39-14-38-20/h2-8,11-12,15,18,32H,9-10,13-14,31H2,1H3,(H,35,36)/t15-,18?/m0/s1 |
| InChIKey | SAVDYPCCGNTQJQ-BUSXIPJBSA-N |
| XLogP | 4.74 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|