About (2R,4R)-2-(3,3-dimethylbutyl)-4-methyl-6-methylideneoxane
(2R,4R)-2-(3,3-dimethylbutyl)-4-methyl-6-methylideneoxane (PubChem CID 59003864) has the molecular formula C13H24O
and a molecular weight of 196.33 g/mol. Its IUPAC name is (2R,4R)-2-(3,3-dimethylbutyl)-4-methyl-6-methylideneoxane.
Molecular Properties
| Compound Name | (2R,4R)-2-(3,3-dimethylbutyl)-4-methyl-6-methylideneoxane |
| PubChem CID | 59003864 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (2R,4R)-2-(3,3-dimethylbutyl)-4-methyl-6-methylideneoxane |
| SMILES | C=C1C[C@H](C)C[C@@H](CCC(C)(C)C)O1 |
| InChI | InChI=1S/C13H24O/c1-10-8-11(2)14-12(9-10)6-7-13(3,4)5/h10,12H,2,6-9H2,1,3-5H3/t10-,12+/m0/s1 |
| InChIKey | SQJWKDWYARHXQM-CMPLNLGQSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,4R)-2-(3,3-dimethylbutyl)-4-methyl-6-methylideneoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-2-(3,3-dimethylbutyl)-4-methyl-6-methylideneoxane?
The IUPAC name of (2R,4R)-2-(3,3-dimethylbutyl)-4-methyl-6-methylideneoxane (CID 59003864) is (2R,4R)-2-(3,3-dimethylbutyl)-4-methyl-6-methylideneoxane.
What is the SMILES notation for (2R,4R)-2-(3,3-dimethylbutyl)-4-methyl-6-methylideneoxane?
The canonical SMILES for (2R,4R)-2-(3,3-dimethylbutyl)-4-methyl-6-methylideneoxane is C=C1C[C@H](C)C[C@@H](CCC(C)(C)C)O1.
What is the InChIKey of (2R,4R)-2-(3,3-dimethylbutyl)-4-methyl-6-methylideneoxane?
The InChIKey is SQJWKDWYARHXQM-CMPLNLGQSA-N. The full InChI is InChI=1S/C13H24O/c1-10-8-11(2)14-12(9-10)6-7-13(3,4)5/h10,12H,2,6-9H2,1,3-5H3/t10-,12+/m0/s1.
What are the key properties of (2R,4R)-2-(3,3-dimethylbutyl)-4-methyl-6-methylideneoxane?
(2R,4R)-2-(3,3-dimethylbutyl)-4-methyl-6-methylideneoxane has a molecular weight of 196.33 g/mol, XLogP of 4.14, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-2-(3,3-dimethylbutyl)-4-methyl-6-methylideneoxane is sourced from PubChem (CID 59003864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).